C34H34N4O5S — CID 67583023
2-[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide (PubChem CID 67583023) has the molecular formula C34H34N4O5S and a molecular weight of 610.74 g/mol. Its IUPAC name is 2-[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 67583023 |
| Molecular Formula | C34H34N4O5S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 2-[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]-2-[(7-methoxynaphthalen-2-yl)sulfonylamino]-N-(3-phenylpropyl)acetamide |
| SMILES | COc1ccc2ccc(S(=O)(=O)NC(C(=O)NCCCc3ccccc3)[C@@H]3CCN(Cc4cccc(C#N)c4)C3=O)cc2c1 |
| InChI | InChI=1S/C34H34N4O5S/c1-43-29-14-12-27-13-15-30(21-28(27)20-29)44(41,42)37-32(33(39)36-17-6-11-24-7-3-2-4-8-24)31-16-18-38(34(31)40)23-26-10-5-9-25(19-26)22-35/h2-5,7-10,12-15,19-21,31-32,37H,6,11,16-18,23H2,1H3,(H,36,39)/t31-,32?/m0/s1 |
| InChIKey | WYGYCTJYBZMDBC-CYZZXXEPSA-N |
| XLogP | 4.16 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|