C10H13N3O2 — CID 54016393
3-(isocyanomethyl)-5-(1-methoxycyclopentyl)-1,2,4-oxadiazole (PubChem CID 54016393) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(isocyanomethyl)-5-(1-methoxycyclopentyl)-1,2,4-oxadiazole.
| Compound Name | 3-(isocyanomethyl)-5-(1-methoxycyclopentyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 54016393 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(isocyanomethyl)-5-(1-methoxycyclopentyl)-1,2,4-oxadiazole |
| SMILES | [C-]#[N+]Cc1noc(C2(OC)CCCC2)n1 |
| InChI | InChI=1S/C10H13N3O2/c1-11-7-8-12-9(15-13-8)10(14-2)5-3-4-6-10/h3-7H2,2H3 |
| InChIKey | KVXRKMCHFPKPRR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|