C9H13BrN2O3 — CID 164649560
3-(bromomethyl)-5-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole (PubChem CID 164649560) has the molecular formula C9H13BrN2O3 and a molecular weight of 277.12 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(bromomethyl)-5-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 164649560 |
| Molecular Formula | C9H13BrN2O3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 3-(bromomethyl)-5-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole |
| SMILES | COC1(c2nc(CBr)no2)CCOCC1 |
| InChI | InChI=1S/C9H13BrN2O3/c1-13-9(2-4-14-5-3-9)8-11-7(6-10)12-15-8/h2-6H2,1H3 |
| InChIKey | ZYRSUXVCLULWKE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|