C16H17N5O3 — CID 154870100
5-(4-methoxyoxan-4-yl)-3-(5-phenyl-2H-triazol-4-yl)-1,2,4-oxadiazole (PubChem CID 154870100) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-(4-methoxyoxan-4-yl)-3-(5-phenyl-2H-triazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-methoxyoxan-4-yl)-3-(5-phenyl-2H-triazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 154870100 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-(4-methoxyoxan-4-yl)-3-(5-phenyl-2H-triazol-4-yl)-1,2,4-oxadiazole |
| SMILES | COC1(c2nc(-c3n[nH]nc3-c3ccccc3)no2)CCOCC1 |
| InChI | InChI=1S/C16H17N5O3/c1-22-16(7-9-23-10-8-16)15-17-14(20-24-15)13-12(18-21-19-13)11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H,18,19,21) |
| InChIKey | IZQWARGPXWYRDP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |