C16H20N2 — CID 54018465
(2S)-1-(7-ethyl-4H-indeno[1,2-b]pyrrol-1-yl)propan-2-amine (PubChem CID 54018465) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (2S)-1-(7-ethyl-4H-indeno[1,2-b]pyrrol-1-yl)propan-2-amine.
| Compound Name | (2S)-1-(7-ethyl-4H-indeno[1,2-b]pyrrol-1-yl)propan-2-amine |
|---|---|
| PubChem CID | 54018465 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (2S)-1-(7-ethyl-4H-indeno[1,2-b]pyrrol-1-yl)propan-2-amine |
| SMILES | CCc1ccc2c(c1)-c1c(ccn1C[C@H](C)N)C2 |
| InChI | InChI=1S/C16H20N2/c1-3-12-4-5-13-9-14-6-7-18(10-11(2)17)16(14)15(13)8-12/h4-8,11H,3,9-10,17H2,1-2H3/t11-/m0/s1 |
| InChIKey | KXGMUCAOWWXRIF-NSHDSACASA-N |
| XLogP | 2.97 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |