C11H13N3O2 — CID 54018694
6-(2,4-dimethylphenyl)-1,3,5-triazinane-2,4-dione (PubChem CID 54018694) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-(2,4-dimethylphenyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 54018694 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-1,3,5-triazinane-2,4-dione |
| SMILES | Cc1ccc(C2NC(=O)NC(=O)N2)c(C)c1 |
| InChI | InChI=1S/C11H13N3O2/c1-6-3-4-8(7(2)5-6)9-12-10(15)14-11(16)13-9/h3-5,9H,1-2H3,(H3,12,13,14,15,16) |
| InChIKey | KXJXSIQCCKTTCF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |