C16H22N4O5 — CID 54021172
1-[(2R,4S,5R)-4-hydroxy-5-[3-(1H-imidazol-5-yl)propoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 54021172) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-[3-(1H-imidazol-5-yl)propoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-[3-(1H-imidazol-5-yl)propoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54021172 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-[3-(1H-imidazol-5-yl)propoxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COCCCc3cnc[nH]3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H22N4O5/c1-10-7-20(16(23)19-15(10)22)14-5-12(21)13(25-14)8-24-4-2-3-11-6-17-9-18-11/h6-7,9,12-14,21H,2-5,8H2,1H3,(H,17,18)(H,19,22,23)/t12-,13+,14+/m0/s1 |
| InChIKey | KZACXMHQQNAANV-BFHYXJOUSA-N |
| XLogP | -0.13 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|