benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate

C21H19NO3 — CID 54022974

IUPACbenzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate
SMILESCC(Oc1cc(-c2ccccc2)ccn1)C(=O)OCc1ccccc1
InChIInChI=1S/C21H19NO3/c1-16(21(23)24-15-17-8-4-2-5-9-17)25-20-14-19(12-13-22-20)18-10-6-3-7-11-18/h2-14,16H,15H2,1H3
InChIKeyLAFJSXVVYJKMLQ-UHFFFAOYSA-N
MW333.39 g/mol
LogP4.26
Rot. Bonds6

About benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate

benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate (PubChem CID 54022974) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate.

Molecular Properties

Compound Namebenzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate
PubChem CID54022974
Molecular FormulaC21H19NO3
Molecular Weight333.39 g/mol
Exact Mass333.14
IUPAC Namebenzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate
SMILESCC(Oc1cc(-c2ccccc2)ccn1)C(=O)OCc1ccccc1
InChIInChI=1S/C21H19NO3/c1-16(21(23)24-15-17-8-4-2-5-9-17)25-20-14-19(12-13-22-20)18-10-6-3-7-11-18/h2-14,16H,15H2,1H3
InChIKeyLAFJSXVVYJKMLQ-UHFFFAOYSA-N
XLogP4.26
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.39
LogP ≤ 54.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate?
The IUPAC name of benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate (CID 54022974) is benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate.
What is the SMILES notation for benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate?
The canonical SMILES for benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate is CC(Oc1cc(-c2ccccc2)ccn1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate?
The InChIKey is LAFJSXVVYJKMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO3/c1-16(21(23)24-15-17-8-4-2-5-9-17)25-20-14-19(12-13-22-20)18-10-6-3-7-11-18/h2-14,16H,15H2,1H3.
What are the key properties of benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate?
benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate has a molecular weight of 333.39 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate is sourced from PubChem (CID 54022974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).