C21H19NO3 — CID 54022974
benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate (PubChem CID 54022974) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate.
| Compound Name | benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate |
|---|---|
| PubChem CID | 54022974 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | benzyl 2-[(4-phenyl-2-pyridinyl)oxy]propanoate |
| SMILES | CC(Oc1cc(-c2ccccc2)ccn1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H19NO3/c1-16(21(23)24-15-17-8-4-2-5-9-17)25-20-14-19(12-13-22-20)18-10-6-3-7-11-18/h2-14,16H,15H2,1H3 |
| InChIKey | LAFJSXVVYJKMLQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |