C23H26N2O4 — CID 54024665
2-[6-(1-methyl-2-pyridin-3-ylindol-3-yl)hexyl]propanedioic acid (PubChem CID 54024665) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[6-(1-methyl-2-pyridin-3-ylindol-3-yl)hexyl]propanedioic acid.
| Compound Name | 2-[6-(1-methyl-2-pyridin-3-ylindol-3-yl)hexyl]propanedioic acid |
|---|---|
| PubChem CID | 54024665 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[6-(1-methyl-2-pyridin-3-ylindol-3-yl)hexyl]propanedioic acid |
| SMILES | Cn1c(-c2cccnc2)c(CCCCCCC(C(=O)O)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O4/c1-25-20-13-7-6-10-17(20)18(21(25)16-9-8-14-24-15-16)11-4-2-3-5-12-19(22(26)27)23(28)29/h6-10,13-15,19H,2-5,11-12H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | LBIGCBNVSYZUEN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|