C25H30N2O4 — CID 70531318
dimethyl 2-[6-(3-methyl-2-pyridin-3-yl-1H-indol-4-yl)hexyl]propanedioate (PubChem CID 70531318) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is dimethyl 2-[6-(3-methyl-2-pyridin-3-yl-1H-indol-4-yl)hexyl]propanedioate.
| Compound Name | dimethyl 2-[6-(3-methyl-2-pyridin-3-yl-1H-indol-4-yl)hexyl]propanedioate |
|---|---|
| PubChem CID | 70531318 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | dimethyl 2-[6-(3-methyl-2-pyridin-3-yl-1H-indol-4-yl)hexyl]propanedioate |
| SMILES | COC(=O)C(CCCCCCc1cccc2[nH]c(-c3cccnc3)c(C)c12)C(=O)OC |
| InChI | InChI=1S/C25H30N2O4/c1-17-22-18(10-6-4-5-7-13-20(24(28)30-2)25(29)31-3)11-8-14-21(22)27-23(17)19-12-9-15-26-16-19/h8-9,11-12,14-16,20,27H,4-7,10,13H2,1-3H3 |
| InChIKey | ZCKDYBWPCHVWCP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|