C16H23N — CID 101334969
4-hexyl-2,3-dimethyl-1H-indole (PubChem CID 101334969) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 4-hexyl-2,3-dimethyl-1H-indole.
| Compound Name | 4-hexyl-2,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 101334969 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 4-hexyl-2,3-dimethyl-1H-indole |
| SMILES | CCCCCCc1cccc2[nH]c(C)c(C)c12 |
| InChI | InChI=1S/C16H23N/c1-4-5-6-7-9-14-10-8-11-15-16(14)12(2)13(3)17-15/h8,10-11,17H,4-7,9H2,1-3H3 |
| InChIKey | KCPWPVAVOMTKOT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|