C21H26F2N4O — CID 54025900
(2R,3R)-3-[4-(cyclopropylmethylidene)piperidin-1-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 54025900) has the molecular formula C21H26F2N4O and a molecular weight of 388.46 g/mol. Its IUPAC name is (2R,3R)-3-[4-(cyclopropylmethylidene)piperidin-1-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2R,3R)-3-[4-(cyclopropylmethylidene)piperidin-1-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 54025900 |
| Molecular Formula | C21H26F2N4O |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (2R,3R)-3-[4-(cyclopropylmethylidene)piperidin-1-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](N1CCC(=CC2CC2)CC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H26F2N4O/c1-15(26-8-6-17(7-9-26)10-16-2-3-16)21(28,12-27-14-24-13-25-27)19-5-4-18(22)11-20(19)23/h4-5,10-11,13-16,28H,2-3,6-9,12H2,1H3/t15-,21-/m1/s1 |
| InChIKey | LCDLXRIJWMHLJB-QVKFZJNVSA-N |
| XLogP | 3.26 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|