C23H32F2N4O — CID 67568292
(2S,3S)-2-(2,4-difluorophenyl)-3-(4-hexylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 67568292) has the molecular formula C23H32F2N4O and a molecular weight of 418.53 g/mol. Its IUPAC name is (2S,3S)-2-(2,4-difluorophenyl)-3-(4-hexylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | (2S,3S)-2-(2,4-difluorophenyl)-3-(4-hexylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 67568292 |
| Molecular Formula | C23H32F2N4O |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (2S,3S)-2-(2,4-difluorophenyl)-3-(4-hexylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CCCCCC=C1CCN([C@@H](C)[C@@](O)(Cn2cncn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C23H32F2N4O/c1-3-4-5-6-7-19-10-12-28(13-11-19)18(2)23(30,15-29-17-26-16-27-29)21-9-8-20(24)14-22(21)25/h7-9,14,16-18,30H,3-6,10-13,15H2,1-2H3/t18-,23-/m0/s1 |
| InChIKey | BDOWHOMKAKETFB-MBSDFSHPSA-N |
| XLogP | 4.44 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|