C10H10F3N5S — CID 54026480
5-methyl-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbothioamide (PubChem CID 54026480) has the molecular formula C10H10F3N5S and a molecular weight of 289.29 g/mol. Its IUPAC name is 5-methyl-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbothioamide.
| Compound Name | 5-methyl-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 54026480 |
| Molecular Formula | C10H10F3N5S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-methyl-1-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]pyrazole-4-carbothioamide |
| SMILES | Cc1c(C(N)=S)cnn1-c1cc(C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C10H10F3N5S/c1-5-6(9(14)19)4-15-18(5)8-3-7(10(11,12)13)17(2)16-8/h3-4H,1-2H3,(H2,14,19) |
| InChIKey | LCNPKXNFMGZWEO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|