C15H23NO2 — CID 54027105
5-tert-butyl-2-(2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione (PubChem CID 54027105) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione.
| Compound Name | 5-tert-butyl-2-(2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54027105 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-tert-butyl-2-(2,3,4,5-tetrahydropyridin-6-yl)cyclohexane-1,3-dione |
| SMILES | CC(C)(C)C1CC(=O)C(C2=NCCCC2)C(=O)C1 |
| InChI | InChI=1S/C15H23NO2/c1-15(2,3)10-8-12(17)14(13(18)9-10)11-6-4-5-7-16-11/h10,14H,4-9H2,1-3H3 |
| InChIKey | LCYSKPXEXHIIJN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|