C26H19N3O7S2 — CID 54028611
(6S,7R)-3-dibenzofuran-2-ylsulfanyl-7-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54028611) has the molecular formula C26H19N3O7S2 and a molecular weight of 549.59 g/mol. Its IUPAC name is (6S,7R)-3-dibenzofuran-2-ylsulfanyl-7-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-dibenzofuran-2-ylsulfanyl-7-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54028611 |
| Molecular Formula | C26H19N3O7S2 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | (6S,7R)-3-dibenzofuran-2-ylsulfanyl-7-[[2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(Sc3ccc4oc5ccccc5c4c3)CS[C@@H]12)c1ccco1 |
| InChI | InChI=1S/C26H19N3O7S2/c1-34-28-20(18-7-4-10-35-18)23(30)27-21-24(31)29-22(26(32)33)19(12-37-25(21)29)38-13-8-9-17-15(11-13)14-5-2-3-6-16(14)36-17/h2-11,21,25H,12H2,1H3,(H,27,30)(H,32,33)/t21-,25+/m1/s1 |
| InChIKey | LDZFEMMQIOGCNB-BWKNWUBXSA-N |
| XLogP | 4.02 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|