C23H29NO2S — CID 54028857
2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-1,2-thiazol-3-one (PubChem CID 54028857) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-1,2-thiazol-3-one.
| Compound Name | 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 54028857 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-1,2-thiazol-3-one |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)n1sccc1=O |
| InChI | InChI=1S/C23H29NO2S/c1-17(11-12-20-19(3)10-7-14-23(20,4)5)8-6-9-18(2)16-22(26)24-21(25)13-15-27-24/h6,8-9,11-13,15-16H,7,10,14H2,1-5H3 |
| InChIKey | LEDNPICXEHBLLW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|