C16H11ClFN3O2 — CID 54029321
7-chloro-5-(2-fluorophenyl)-2-(nitromethyl)-3H-1,4-benzodiazepine (PubChem CID 54029321) has the molecular formula C16H11ClFN3O2 and a molecular weight of 331.73 g/mol. Its IUPAC name is 7-chloro-5-(2-fluorophenyl)-2-(nitromethyl)-3H-1,4-benzodiazepine.
| Compound Name | 7-chloro-5-(2-fluorophenyl)-2-(nitromethyl)-3H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 54029321 |
| Molecular Formula | C16H11ClFN3O2 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 7-chloro-5-(2-fluorophenyl)-2-(nitromethyl)-3H-1,4-benzodiazepine |
| SMILES | O=[N+]([O-])CC1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C16H11ClFN3O2/c17-10-5-6-15-13(7-10)16(12-3-1-2-4-14(12)18)19-8-11(20-15)9-21(22)23/h1-7H,8-9H2 |
| InChIKey | LELIPNVLIDBHRM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|