C18H18ClFN2OSi — CID 91743850
[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy-trimethylsilane (PubChem CID 91743850) has the molecular formula C18H18ClFN2OSi and a molecular weight of 360.89 g/mol. Its IUPAC name is [7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy-trimethylsilane.
| Compound Name | [7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91743850 |
| Molecular Formula | C18H18ClFN2OSi |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | [7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C18H18ClFN2OSi/c1-24(2,3)23-17-11-21-18(13-6-4-5-7-15(13)20)14-10-12(19)8-9-16(14)22-17/h4-10H,11H2,1-3H3 |
| InChIKey | MBEIVOZTUIDFGV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|