C21H24ClFN2OSi — CID 91747112
tert-butyl-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy]-dimethylsilane (PubChem CID 91747112) has the molecular formula C21H24ClFN2OSi and a molecular weight of 402.97 g/mol. Its IUPAC name is tert-butyl-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 91747112 |
| Molecular Formula | C21H24ClFN2OSi |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | tert-butyl-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C21H24ClFN2OSi/c1-21(2,3)27(4,5)26-19-13-24-20(15-8-6-7-9-17(15)23)16-12-14(22)10-11-18(16)25-19/h6-12H,13H2,1-5H3 |
| InChIKey | VGOMYOJOFLKKCP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|