C16H13ClFN3O — CID 57005308
N-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]methyl]hydroxylamine (PubChem CID 57005308) has the molecular formula C16H13ClFN3O and a molecular weight of 317.75 g/mol. Its IUPAC name is N-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]methyl]hydroxylamine.
| Compound Name | N-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 57005308 |
| Molecular Formula | C16H13ClFN3O |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[[7-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]methyl]hydroxylamine |
| SMILES | ONCC1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C16H13ClFN3O/c17-10-5-6-15-13(7-10)16(12-3-1-2-4-14(12)18)19-8-11(21-15)9-20-22/h1-7,20,22H,8-9H2 |
| InChIKey | WDTVFDJMJQEJJR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|