C20H31N3O4 — CID 54033337
[1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-(4-methylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate (PubChem CID 54033337) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is [1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-(4-methylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate.
| Compound Name | [1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-(4-methylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 54033337 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | [1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-(4-methylpiperazin-1-yl)propan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(CN1CCN(C)CC1)Cn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C20H31N3O4/c1-14(2)20(26)27-15(12-22-10-8-21(3)9-11-22)13-23-18(24)16-6-4-5-7-17(16)19(23)25/h4-5,14-15,24-25H,6-13H2,1-3H3 |
| InChIKey | LHECLCSGEPMTJW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|