About [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate
[di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate (PubChem CID 54033596) has the molecular formula C12H22N2S2
and a molecular weight of 258.46 g/mol. Its IUPAC name is [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate.
Molecular Properties
| Compound Name | [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate |
| PubChem CID | 54033596 |
| Molecular Formula | C12H22N2S2 |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate |
| SMILES | CC(C)NC(=S)SN(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C12H22N2S2/c1-9(2)13-12(15)16-14(10-5-3-6-10)11-7-4-8-11/h9-11H,3-8H2,1-2H3,(H,13,15) |
| InChIKey | LHIPGNVJIUAYCI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate?
The IUPAC name of [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate (CID 54033596) is [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate.
What is the SMILES notation for [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate?
The canonical SMILES for [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate is CC(C)NC(=S)SN(C1CCC1)C1CCC1.
What is the InChIKey of [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate?
The InChIKey is LHIPGNVJIUAYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2S2/c1-9(2)13-12(15)16-14(10-5-3-6-10)11-7-4-8-11/h9-11H,3-8H2,1-2H3,(H,13,15).
What are the key properties of [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate?
[di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate has a molecular weight of 258.46 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [di(cyclobutyl)amino] N-propan-2-ylcarbamodithioate is sourced from PubChem (CID 54033596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).