C15H25NO6 — CID 540384
diethyl 1-acetyl-5-hydroxy-4-propylpyrrolidine-2,2-dicarboxylate (PubChem CID 540384) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is diethyl 1-acetyl-5-hydroxy-4-propylpyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl 1-acetyl-5-hydroxy-4-propylpyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 540384 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | diethyl 1-acetyl-5-hydroxy-4-propylpyrrolidine-2,2-dicarboxylate |
| SMILES | CCCC1CC(C(=O)OCC)(C(=O)OCC)N(C(C)=O)C1O |
| InChI | InChI=1S/C15H25NO6/c1-5-8-11-9-15(13(19)21-6-2,14(20)22-7-3)16(10(4)17)12(11)18/h11-12,18H,5-9H2,1-4H3 |
| InChIKey | BYVNBYCJAKEYFV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|