C17H15ClF3NO2 — CID 54038422
2-[2-chloro-5-(trifluoromethyl)phenyl]-5,6-dimethyl-4,7-dihydroisoindole-1,3-diol (PubChem CID 54038422) has the molecular formula C17H15ClF3NO2 and a molecular weight of 357.76 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]-5,6-dimethyl-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-5,6-dimethyl-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54038422 |
| Molecular Formula | C17H15ClF3NO2 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-5,6-dimethyl-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC1=C(C)Cc2c(c(O)n(-c3cc(C(F)(F)F)ccc3Cl)c2O)C1 |
| InChI | InChI=1S/C17H15ClF3NO2/c1-8-5-11-12(6-9(8)2)16(24)22(15(11)23)14-7-10(17(19,20)21)3-4-13(14)18/h3-4,7,23-24H,5-6H2,1-2H3 |
| InChIKey | LKPRZZORRHHIBF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|