C30H31N5O6 — CID 54038683
3-[[5,7-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-4-phenyl-1,4-diazepan-6-yl]carbamoylamino]benzoic acid (PubChem CID 54038683) has the molecular formula C30H31N5O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is 3-[[5,7-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-4-phenyl-1,4-diazepan-6-yl]carbamoylamino]benzoic acid.
| Compound Name | 3-[[5,7-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-4-phenyl-1,4-diazepan-6-yl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 54038683 |
| Molecular Formula | C30H31N5O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 3-[[5,7-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-4-phenyl-1,4-diazepan-6-yl]carbamoylamino]benzoic acid |
| SMILES | CC(C)N(C(=O)CN1CCN(c2ccccc2)C(=O)C(NC(=O)Nc2cccc(C(=O)O)c2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C30H31N5O6/c1-20(2)35(24-14-7-4-8-15-24)25(36)19-33-16-17-34(23-12-5-3-6-13-23)28(38)26(27(33)37)32-30(41)31-22-11-9-10-21(18-22)29(39)40/h3-15,18,20,26H,16-17,19H2,1-2H3,(H,39,40)(H2,31,32,41) |
| InChIKey | LKUAAOXYLYVFAP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|