C20H28N2O6 — CID 54039338
1-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol (PubChem CID 54039338) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol.
| Compound Name | 1-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 54039338 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1-[[4,5-bis(hydroxymethyl)-2-methyl-3-pyridinyl]oxy]-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol |
| SMILES | COc1ccccc1OCCNCC(O)COc1c(C)ncc(CO)c1CO |
| InChI | InChI=1S/C20H28N2O6/c1-14-20(17(12-24)15(11-23)9-22-14)28-13-16(25)10-21-7-8-27-19-6-4-3-5-18(19)26-2/h3-6,9,16,21,23-25H,7-8,10-13H2,1-2H3 |
| InChIKey | LLFSRHZTWRJCBS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|