About 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol
2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol (PubChem CID 54042004) has the molecular formula C16H14BrN3O3
and a molecular weight of 376.21 g/mol. Its IUPAC name is 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol.
Molecular Properties
| Compound Name | 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol |
| PubChem CID | 54042004 |
| Molecular Formula | C16H14BrN3O3 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol |
| SMILES | COc1cc2cnc(Nc3ccc(O)c(Br)c3)nc2cc1OC |
| InChI | InChI=1S/C16H14BrN3O3/c1-22-14-5-9-8-18-16(20-12(9)7-15(14)23-2)19-10-3-4-13(21)11(17)6-10/h3-8,21H,1-2H3,(H,18,19,20) |
| InChIKey | LNABCKJYWYDUSK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol?
The IUPAC name of 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol (CID 54042004) is 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol.
What is the SMILES notation for 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol?
The canonical SMILES for 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol is COc1cc2cnc(Nc3ccc(O)c(Br)c3)nc2cc1OC.
What is the InChIKey of 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol?
The InChIKey is LNABCKJYWYDUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN3O3/c1-22-14-5-9-8-18-16(20-12(9)7-15(14)23-2)19-10-3-4-13(21)11(17)6-10/h3-8,21H,1-2H3,(H,18,19,20).
What are the key properties of 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol?
2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol has a molecular weight of 376.21 g/mol, XLogP of 3.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(6,7-dimethoxyquinazolin-2-yl)amino]phenol is sourced from PubChem (CID 54042004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).