C17H19BrClN3O4 — CID 139058076
2-bromo-4-[(6,7-dimethoxyquinazolin-3-ium-4-yl)amino]phenol;methanol;chloride (PubChem CID 139058076) has the molecular formula C17H19BrClN3O4 and a molecular weight of 444.71 g/mol. Its IUPAC name is 2-bromo-4-[(6,7-dimethoxyquinazolin-3-ium-4-yl)amino]phenol;methanol;chloride.
| Compound Name | 2-bromo-4-[(6,7-dimethoxyquinazolin-3-ium-4-yl)amino]phenol;methanol;chloride |
|---|---|
| PubChem CID | 139058076 |
| Molecular Formula | C17H19BrClN3O4 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 2-bromo-4-[(6,7-dimethoxyquinazolin-3-ium-4-yl)amino]phenol;methanol;chloride |
| SMILES | CO.COc1cc2nc[nH+]c(Nc3ccc(O)c(Br)c3)c2cc1OC.[Cl-] |
| InChI | InChI=1S/C16H14BrN3O3.CH4O.ClH/c1-22-14-6-10-12(7-15(14)23-2)18-8-19-16(10)20-9-3-4-13(21)11(17)5-9;1-2;/h3-8,21H,1-2H3,(H,18,19,20);2H,1H3;1H |
| InChIKey | YFTMMOCOODEWAG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|