C16H14BrN3O3 — CID 23863723
4-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-2-bromophenol (PubChem CID 23863723) has the molecular formula C16H14BrN3O3 and a molecular weight of 376.21 g/mol. Its IUPAC name is 4-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-2-bromophenol.
| Compound Name | 4-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-2-bromophenol |
|---|---|
| PubChem CID | 23863723 |
| Molecular Formula | C16H14BrN3O3 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 4-[[6,7-bis(hydroxymethyl)quinazolin-4-yl]amino]-2-bromophenol |
| SMILES | OCc1cc2ncnc(Nc3ccc(O)c(Br)c3)c2cc1CO |
| InChI | InChI=1S/C16H14BrN3O3/c17-13-5-11(1-2-15(13)23)20-16-12-3-9(6-21)10(7-22)4-14(12)18-8-19-16/h1-5,8,21-23H,6-7H2,(H,18,19,20) |
| InChIKey | RSVADWBQBHUWNS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|