C21H19Cl2N — CID 54046222
1-(3,4-dichlorophenyl)-1,1-diphenylpropan-2-amine (PubChem CID 54046222) has the molecular formula C21H19Cl2N and a molecular weight of 356.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-1,1-diphenylpropan-2-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-1,1-diphenylpropan-2-amine |
|---|---|
| PubChem CID | 54046222 |
| Molecular Formula | C21H19Cl2N |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-1,1-diphenylpropan-2-amine |
| SMILES | CC(N)C(c1ccccc1)(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N/c1-15(24)21(16-8-4-2-5-9-16,17-10-6-3-7-11-17)18-12-13-19(22)20(23)14-18/h2-15H,24H2,1H3 |
| InChIKey | LPTRDHYWTOULHQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|