C12H19NO — CID 54046351
tricyclo[4.3.1.12,5]undecane-1-carboxamide (PubChem CID 54046351) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is tricyclo[4.3.1.12,5]undecane-1-carboxamide.
| Compound Name | tricyclo[4.3.1.12,5]undecane-1-carboxamide |
|---|---|
| PubChem CID | 54046351 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | tricyclo[4.3.1.12,5]undecane-1-carboxamide |
| SMILES | NC(=O)C12CCCC(C1)C1CCC2C1 |
| InChI | InChI=1S/C12H19NO/c13-11(14)12-5-1-2-9(7-12)8-3-4-10(12)6-8/h8-10H,1-7H2,(H2,13,14) |
| InChIKey | LPVWGXGUUQRSKZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |