C12H19NO — CID 70267295
(1R,3S,7S)-tricyclo[5.3.1.03,9]undecane-1-carboxamide (PubChem CID 70267295) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (1R,3S,7S)-tricyclo[5.3.1.03,9]undecane-1-carboxamide.
| Compound Name | (1R,3S,7S)-tricyclo[5.3.1.03,9]undecane-1-carboxamide |
|---|---|
| PubChem CID | 70267295 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (1R,3S,7S)-tricyclo[5.3.1.03,9]undecane-1-carboxamide |
| SMILES | NC(=O)[C@@]12CC3C[C@H](CCC[C@H]3C1)C2 |
| InChI | InChI=1S/C12H19NO/c13-11(14)12-5-8-2-1-3-9(6-12)10(4-8)7-12/h8-10H,1-7H2,(H2,13,14)/t8-,9-,10?,12+/m0/s1 |
| InChIKey | HZQDQENAKTUWIH-NBEZOXGKSA-N |
| XLogP | 2.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |