C14H13N3S2 — CID 5404826
[(Z)-2,3-dihydrobenzo[f]thiochromen-1-ylideneamino]thiourea (PubChem CID 5404826) has the molecular formula C14H13N3S2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(Z)-2,3-dihydrobenzo[f]thiochromen-1-ylideneamino]thiourea.
| Compound Name | [(Z)-2,3-dihydrobenzo[f]thiochromen-1-ylideneamino]thiourea |
|---|---|
| PubChem CID | 5404826 |
| Molecular Formula | C14H13N3S2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | [(Z)-2,3-dihydrobenzo[f]thiochromen-1-ylideneamino]thiourea |
| SMILES | C\1CSC2=C(/C1=N\NC(=S)N)C3=CC=CC=C3C=C2 |
| InChI | InChI=1S/C14H13N3S2/c15-14(18)17-16-11-7-8-19-12-6-5-9-3-1-2-4-10(9)13(11)12/h1-6H,7-8H2,(H3,15,17,18)/b16-11- |
| InChIKey | OIQDTDZIZWPLBP-WJDWOHSUSA-N |
| XLogP | 3.00 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | 383 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|