C24H29NO5 — CID 54051113
2-[[4-(1-ethoxy-1-oxooctan-2-yl)phenyl]carbamoyl]benzoic acid (PubChem CID 54051113) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-[[4-(1-ethoxy-1-oxooctan-2-yl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-(1-ethoxy-1-oxooctan-2-yl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 54051113 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[[4-(1-ethoxy-1-oxooctan-2-yl)phenyl]carbamoyl]benzoic acid |
| SMILES | CCCCCCC(C(=O)OCC)c1ccc(NC(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H29NO5/c1-3-5-6-7-10-19(24(29)30-4-2)17-13-15-18(16-14-17)25-22(26)20-11-8-9-12-21(20)23(27)28/h8-9,11-16,19H,3-7,10H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | LSXPZJFIPJOVKG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|