C24H29NO3 — CID 54052088
[3-methyl-1-(4-prop-1-en-2-ylphenoxy)-3-(4-prop-1-en-2-ylphenyl)butan-2-yl]carbamic acid (PubChem CID 54052088) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is [3-methyl-1-(4-prop-1-en-2-ylphenoxy)-3-(4-prop-1-en-2-ylphenyl)butan-2-yl]carbamic acid.
| Compound Name | [3-methyl-1-(4-prop-1-en-2-ylphenoxy)-3-(4-prop-1-en-2-ylphenyl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 54052088 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [3-methyl-1-(4-prop-1-en-2-ylphenoxy)-3-(4-prop-1-en-2-ylphenyl)butan-2-yl]carbamic acid |
| SMILES | C=C(C)c1ccc(OCC(NC(=O)O)C(C)(C)c2ccc(C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-16(2)18-7-11-20(12-8-18)24(5,6)22(25-23(26)27)15-28-21-13-9-19(10-14-21)17(3)4/h7-14,22,25H,1,3,15H2,2,4-6H3,(H,26,27) |
| InChIKey | LTPIGRREYDIRLF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |