C20H20Cl2N2O2 — CID 54052284
3-[2,3-dichloro-6-(2-methoxyphenyl)phenyl]-1-piperazin-1-ylprop-2-en-1-one (PubChem CID 54052284) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 3-[2,3-dichloro-6-(2-methoxyphenyl)phenyl]-1-piperazin-1-ylprop-2-en-1-one.
| Compound Name | 3-[2,3-dichloro-6-(2-methoxyphenyl)phenyl]-1-piperazin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 54052284 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-[2,3-dichloro-6-(2-methoxyphenyl)phenyl]-1-piperazin-1-ylprop-2-en-1-one |
| SMILES | COc1ccccc1-c1ccc(Cl)c(Cl)c1C=CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c1-26-18-5-3-2-4-15(18)14-6-8-17(21)20(22)16(14)7-9-19(25)24-12-10-23-11-13-24/h2-9,23H,10-13H2,1H3 |
| InChIKey | JQVCHVRSMQNJDK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|