C26H32Cl2N2O3 — CID 173202832
(E)-3-[2,3-dichloro-6-(2-propan-2-ylphenyl)phenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 173202832) has the molecular formula C26H32Cl2N2O3 and a molecular weight of 491.46 g/mol. Its IUPAC name is (E)-3-[2,3-dichloro-6-(2-propan-2-ylphenyl)phenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2,3-dichloro-6-(2-propan-2-ylphenyl)phenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 173202832 |
| Molecular Formula | C26H32Cl2N2O3 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (E)-3-[2,3-dichloro-6-(2-propan-2-ylphenyl)phenyl]-1-[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CC(C)c1ccccc1-c1ccc(Cl)c(Cl)c1/C=C/C(=O)N1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C26H32Cl2N2O3/c1-19(2)20-5-3-4-6-21(20)22-7-9-24(27)26(28)23(22)8-10-25(32)30-13-11-29(12-14-30)15-17-33-18-16-31/h3-10,19,31H,11-18H2,1-2H3/b10-8+ |
| InChIKey | ZLMQKNWVJNMZPJ-CSKARUKUSA-N |
| XLogP | 4.95 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|