C24H38O4 — CID 54052594
[8-[2-(4-hydroxyoxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 54052594) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [8-[2-(4-hydroxyoxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[2-(4-hydroxyoxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 54052594 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [8-[2-(4-hydroxyoxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O)CCO3)C21 |
| InChI | InChI=1S/C24H38O4/c1-5-16(3)24(26)28-22-13-15(2)12-18-7-6-17(4)21(23(18)22)9-8-20-14-19(25)10-11-27-20/h6-7,12,15-17,19-23,25H,5,8-11,13-14H2,1-4H3 |
| InChIKey | LTYULWLPJLLPRS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |