C25H38O4 — CID 70858902
[(1S,3R)-8-[2-[(1R)-3-hydroxy-5-oxocyclohexyl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 70858902) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is [(1S,3R)-8-[2-[(1R)-3-hydroxy-5-oxocyclohexyl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(1S,3R)-8-[2-[(1R)-3-hydroxy-5-oxocyclohexyl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 70858902 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(1S,3R)-8-[2-[(1R)-3-hydroxy-5-oxocyclohexyl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=CC(C)C(CC[C@H]3CC(=O)CC(O)C3)C21 |
| InChI | InChI=1S/C25H38O4/c1-5-16(3)25(28)29-23-11-15(2)10-19-8-6-17(4)22(24(19)23)9-7-18-12-20(26)14-21(27)13-18/h6,8,10,15-18,20,22-24,26H,5,7,9,11-14H2,1-4H3/t15-,16?,17?,18+,20?,22?,23-,24?/m0/s1 |
| InChIKey | CYXSUYXCGLMQNH-WXPVLMEXSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |