C20H17N5O — CID 54053165
1-(3-aminophenyl)-2-methyl-5-(2-pyridin-3-ylethenyl)pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 54053165) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2-methyl-5-(2-pyridin-3-ylethenyl)pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 1-(3-aminophenyl)-2-methyl-5-(2-pyridin-3-ylethenyl)pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 54053165 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(3-aminophenyl)-2-methyl-5-(2-pyridin-3-ylethenyl)pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc2nc(C=Cc3cccnc3)cc(=O)n2n1-c1cccc(N)c1 |
| InChI | InChI=1S/C20H17N5O/c1-14-10-19-23-17(8-7-15-4-3-9-22-13-15)12-20(26)25(19)24(14)18-6-2-5-16(21)11-18/h2-13H,21H2,1H3 |
| InChIKey | LUJLSUUISWAUEY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|