C21H22F3N3O5 — CID 54053289
[4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]-1-propylpyrazol-5-yl] 2,2,2-trifluoroacetate (PubChem CID 54053289) has the molecular formula C21H22F3N3O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is [4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]-1-propylpyrazol-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]-1-propylpyrazol-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54053289 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [4-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-nitrobenzoyl]-1-propylpyrazol-5-yl] 2,2,2-trifluoroacetate |
| SMILES | CCCn1ncc(C(=O)c2ccc([N+](=O)[O-])c(C(C)=C(C)C)c2C)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H22F3N3O5/c1-6-9-26-19(32-20(29)21(22,23)24)15(10-25-26)18(28)14-7-8-16(27(30)31)17(13(14)5)12(4)11(2)3/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | LULRAYKVEBSGFN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|