C13H13NO3 — CID 54053900
4,7-dimethylidene-2-(oxiran-2-ylmethyl)isoindole-1,3-diol (PubChem CID 54053900) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4,7-dimethylidene-2-(oxiran-2-ylmethyl)isoindole-1,3-diol.
| Compound Name | 4,7-dimethylidene-2-(oxiran-2-ylmethyl)isoindole-1,3-diol |
|---|---|
| PubChem CID | 54053900 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4,7-dimethylidene-2-(oxiran-2-ylmethyl)isoindole-1,3-diol |
| SMILES | C=c1ccc(=C)c2c(O)n(CC3CO3)c(O)c12 |
| InChI | InChI=1S/C13H13NO3/c1-7-3-4-8(2)11-10(7)12(15)14(13(11)16)5-9-6-17-9/h3-4,9,15-16H,1-2,5-6H2 |
| InChIKey | LUWKEGNDDOMOAS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|