C12H22N2 — CID 54054394
N,N,7-trimethyl-4-azatricyclo[5.2.1.02,6]decan-1-amine (PubChem CID 54054394) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N,N,7-trimethyl-4-azatricyclo[5.2.1.02,6]decan-1-amine.
| Compound Name | N,N,7-trimethyl-4-azatricyclo[5.2.1.02,6]decan-1-amine |
|---|---|
| PubChem CID | 54054394 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N,N,7-trimethyl-4-azatricyclo[5.2.1.02,6]decan-1-amine |
| SMILES | CN(C)C12CCC(C)(C1)C1CNCC12 |
| InChI | InChI=1S/C12H22N2/c1-11-4-5-12(8-11,14(2)3)10-7-13-6-9(10)11/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | LVFLTPADCBQOKG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |