C23H38O3 — CID 54054578
2,9,13-trimethyl-1-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one (PubChem CID 54054578) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 2,9,13-trimethyl-1-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one.
| Compound Name | 2,9,13-trimethyl-1-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one |
|---|---|
| PubChem CID | 54054578 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 2,9,13-trimethyl-1-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one |
| SMILES | CC=C(C)CCC=C(C)CCC(=O)CCC=C(C)COC1CCCCO1 |
| InChI | InChI=1S/C23H38O3/c1-5-19(2)10-8-11-20(3)15-16-22(24)13-9-12-21(4)18-26-23-14-6-7-17-25-23/h5,11-12,23H,6-10,13-18H2,1-4H3 |
| InChIKey | LVIVXJWBIVBNAV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|