C18H30O3 — CID 10085835
(5E,9E)-6,10-dimethyl-11-(oxan-2-yloxy)undeca-5,9-dien-2-one (PubChem CID 10085835) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (5E,9E)-6,10-dimethyl-11-(oxan-2-yloxy)undeca-5,9-dien-2-one.
| Compound Name | (5E,9E)-6,10-dimethyl-11-(oxan-2-yloxy)undeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 10085835 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (5E,9E)-6,10-dimethyl-11-(oxan-2-yloxy)undeca-5,9-dien-2-one |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)COC1CCCCO1 |
| InChI | InChI=1S/C18H30O3/c1-15(9-7-11-17(3)19)8-6-10-16(2)14-21-18-12-4-5-13-20-18/h9-10,18H,4-8,11-14H2,1-3H3/b15-9+,16-10+ |
| InChIKey | KBLSZPXECGDEFD-KAVGSWPWSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|