C25H37NO4 — CID 54054826
(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 54054826) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 54054826 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2-morpholin-4-yl-1,2,3,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@H](O)C(N5CCOCC5)C[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C25H37NO4/c1-15(27)18-6-7-19-17-5-4-16-12-21(28)20(26-8-10-30-11-9-26)13-24(16,2)23(17)22(29)14-25(18,19)3/h12,17-21,23,28H,4-11,13-14H2,1-3H3/t17-,18+,19-,20?,21-,23+,24-,25+/m0/s1 |
| InChIKey | LVMTWPWBCLIQGC-XHZHCSSXSA-N |
| XLogP | 3.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|