C16H22N2O4 — CID 54056950
ethyl 2-[[(4S)-4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl]amino]-2-oxoacetate (PubChem CID 54056950) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl 2-[[(4S)-4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[(4S)-4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 54056950 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl 2-[[(4S)-4-benzyl-2,2-dimethyl-1,3-oxazolidin-3-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NN1[C@@H](Cc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C16H22N2O4/c1-4-21-15(20)14(19)17-18-13(11-22-16(18,2)3)10-12-8-6-5-7-9-12/h5-9,13H,4,10-11H2,1-3H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | LWXPACBINBXCJI-ZDUSSCGKSA-N |
| XLogP | 1.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|