C18H16ClNO4 — CID 54058355
4-(2-chlorophenyl)-5-methoxycarbonyl-2-methyl-6-prop-1-ynyl-3,4-dihydropyridine-3-carboxylic acid (PubChem CID 54058355) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-methoxycarbonyl-2-methyl-6-prop-1-ynyl-3,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 4-(2-chlorophenyl)-5-methoxycarbonyl-2-methyl-6-prop-1-ynyl-3,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54058355 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-(2-chlorophenyl)-5-methoxycarbonyl-2-methyl-6-prop-1-ynyl-3,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC#CC1=C(C(=O)OC)C(c2ccccc2Cl)C(C(=O)O)C(C)=N1 |
| InChI | InChI=1S/C18H16ClNO4/c1-4-7-13-16(18(23)24-3)15(11-8-5-6-9-12(11)19)14(17(21)22)10(2)20-13/h5-6,8-9,14-15H,1-3H3,(H,21,22) |
| InChIKey | LXWNUIWMJARHJO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|