C9H10F7NO3 — CID 540601
propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)acetate (PubChem CID 540601) has the molecular formula C9H10F7NO3 and a molecular weight of 313.17 g/mol. Its IUPAC name is propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)acetate.
| Compound Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)acetate |
|---|---|
| PubChem CID | 540601 |
| Molecular Formula | C9H10F7NO3 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)acetate |
| SMILES | CCCOC(=O)CNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F7NO3/c1-2-3-20-5(18)4-17-6(19)7(10,11)8(12,13)9(14,15)16/h2-4H2,1H3,(H,17,19) |
| InChIKey | IDJVVUQVCZCVPE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|